144118-44-5 Usage
Uses
Used in Pharmaceutical Industry:
(R)-(-)-1,2-Diaminopropane sulfate is used as a chiral building block for the synthesis of pharmaceuticals. Its unique structure allows for the creation of various medicinal compounds with specific therapeutic properties, contributing to the development of novel drugs.
Used in Chemical Industry:
(R)-(-)-1,2-Diaminopropane sulfate serves as a resolving agent for enantiomeric mixtures. This application is crucial in obtaining pure enantiomers, which are essential for ensuring the desired biological activity and minimizing potential side effects of chiral drugs.
Used in Coordination Chemistry:
In coordination chemistry, (R)-(-)-1,2-Diaminopropane sulfate is utilized as a ligand. Its incorporation into metal complexes can lead to the formation of novel compounds with unique properties and potential applications in various fields.
Used in Organic Synthesis:
(R)-(-)-1,2-Diaminopropane sulfate is employed as a reagent for the synthesis of other complex organic compounds. Its versatility in organic synthesis allows for the creation of a wide range of molecules with diverse applications, from pharmaceuticals to specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 144118-44-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,4,1,1 and 8 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 144118-44:
(8*1)+(7*4)+(6*4)+(5*1)+(4*1)+(3*8)+(2*4)+(1*4)=105
105 % 10 = 5
So 144118-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C3H10N2.H2O4S/c1-3(5)2-4;1-5(2,3)4/h3H,2,4-5H2,1H3;(H2,1,2,3,4)/t3-;/m1./s1
