14541-93-6 Usage
Uses
Used in Pharmaceutical Industry:
6-NITRO-BENZOOXAZOLE-2-THIOL is used as a building block for the synthesis of various pharmaceuticals due to its potential biological activities, such as antimicrobial and anticancer properties. Its presence in drug molecules can contribute to enhanced therapeutic effects and target specific biological pathways.
Used in Organic Synthesis:
6-NITRO-BENZOOXAZOLE-2-THIOL is used as a reagent in chemical reactions, particularly for the formation of carbon-sulfur bonds. Its chemical structure and properties make it a valuable tool for scientists and researchers in the field of organic synthesis, enabling the creation of novel compounds with diverse applications.
Used in Medicinal Chemistry:
In the realm of medicinal chemistry, 6-NITRO-BENZOOXAZOLE-2-THIOL is utilized for its potential to be incorporated into drug molecules, enhancing their efficacy and selectivity. Its unique structure allows for the development of new therapeutic agents with improved pharmacological profiles.
Overall, 6-NITRO-BENZOOXAZOLE-2-THIOL's diverse applications across various industries highlight its importance as a key component in the development of new pharmaceuticals, organic compounds, and chemical reagents. Its unique properties and potential for further research make it a promising candidate for future scientific advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 14541-93-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,4 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14541-93:
(7*1)+(6*4)+(5*5)+(4*4)+(3*1)+(2*9)+(1*3)=96
96 % 10 = 6
So 14541-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N2O3S/c10-9(11)4-1-2-5-6(3-4)12-7(13)8-5/h1-3H,(H,8,13)
