154492-74-7

Usage

Uses

Used in Organic Synthesis:
PHENOXY-D5-ACETIC ACID is used as a synthetic building block for the development of new organic compounds. Its unique chemical properties allow it to be a versatile component in the synthesis of a wide range of molecules, contributing to the advancement of chemical research and the creation of novel materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, PHENOXY-D5-ACETIC ACID is used as a key intermediate in the synthesis of various drugs. Its incorporation into drug molecules can enhance their efficacy, selectivity, and pharmacokinetic properties, ultimately leading to the development of more effective therapeutic agents.
Used in Chemical Research:
PHENOXY-D5-ACETIC ACID is also employed in chemical research as a model compound for studying various reaction mechanisms and exploring new synthetic routes. Its use in research helps to expand the understanding of organic chemistry and contributes to the discovery of innovative chemical processes and methodologies.
Used in Material Science:
In the field of material science, PHENOXY-D5-ACETIC ACID can be used as a component in the development of new materials with specific properties. Its incorporation into polymers, for example, can lead to materials with enhanced mechanical, thermal, or electrical properties, depending on the desired application.
Overall, PHENOXY-D5-ACETIC ACID is a versatile compound with a wide range of applications across various industries, including organic synthesis, pharmaceuticals, chemical research, and material science. Its unique properties and potential for use in the development of new compounds make it an essential tool in the advancement of these fields.

InChI:InChI=1/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)/i1D,2D,3D,4D,5D

Upstream product

• 4165-62-2 phenol-d5 
• 79-11-8 chloroacetic acid 

Downstream Products

• 107462-97-5 phenoxyacetyl-d5 chloride 

Relevant academic research and scientific papers

Method of using deuterated calcium channel blockers

A method of enhancing the efficiency and increasing the duration of action of drugs (e.g. dihydropyridines and anti-bacterials) and particularly of nifedipine and penicillins wherein one or more hydrogen atoms are deuterated and wherein the deuterated drug has unexpectedly improved properties when used in much lower concentrations than unmodified drug. A method for determining the identity and bioequivalency of a new drug is also disclosed wherein the molecular and isotope structure of a new drug is determined by isotope ratio mass spectrometry and compared with the molecular and isotope structure of a known human drug.

Skeletal Rearrangements Preceding CO Loss from Metastable Phenoxymethylene Ions Derived from Phenoxyacetic Acid and Anisole

The loss of CHO2(.) from the molecular ion of phenoxyacetic acid and the expulsion of an H(.) atom from ionized anisole lead to phenoxymethylene ions, which fragment predominantly by CO loss on the microsecond time-scale.Carbon-13 labelling reveals that ca. 90percent of the CO molecules expelled from the metastable ions derived from phenoxyacetic acid incorporate the carbon atom from the 1-position of the phenyl group of the parent compound, whereas the residual CO molecules contain one of the other carbon atoms of the aromatic ring.The 2-fluoro- and 2-methylphenoxymethylene ions derived from the appropriate aryloxyacetic acids behave similarly, i.e. the carbon atom of the methylene group of the parent compound is not incorporated in the expelled CO molecules.In contrast, ca. 45percent of the CO molecules eliminated from the metastable phenoxymethylene ions formed from ionized anisole contain the carbon atom of the methyl group, while the remaining part contains the carbon atom from the 1-position of the phenyl ring of the parent compound.This result is taken as evidence for the occurrence of a skeletal rearrangement of the anisole molecular ion leading to an interchange between the carbon atom of the methyl group and the carbon atom at the 1-position of the ring.The elimination of CO from the metastable ions generated from either phenoxyacetic acid or anisole gives rise to a composite metastable peak.Conclusive evidence as to the formation of (+) isomers other than the phenoxymethylene ion is not obtained, indicating that the composite metastable peak is a result of two competing reactions both leading to CO loss.Possible mechanisms of these reactions are discussed together with the mechanism of the skeletal rearrangement of the molecular ion of anisole prior to H(.) loss.