155272-07-4 Usage
Uses
Used in Pharmaceutical Applications:
(E)-8-(4-(4-bromobutoxy)styryl)-1,3-diethyl-7-methylxanthine is used as a therapeutic agent for various medical conditions, including neurological disorders, cancer, and metabolic diseases. Its unique structure and properties make it a valuable tool for studying the biological effects of caffeine and related xanthine derivatives in the human body.
Used in Research Applications:
In the field of research, (E)-8-(4-(4-bromobutoxy)styryl)-1,3-diethyl-7-methylxanthine serves as a key compound for investigating the mechanisms of action and potential therapeutic benefits of caffeine and its derivatives. (E)-8-(4-(4-bromobutoxy)styryl)-1,3-diethyl-7-methylxanthine's complex structure allows researchers to explore its interactions with various biological targets and pathways, contributing to a deeper understanding of xanthine-based compounds' effects on human health.
Used in Drug Development:
(E)-8-(4-(4-bromobutoxy)styryl)-1,3-diethyl-7-methylxanthine is also utilized in the development of new drugs targeting specific medical conditions. Its unique structure and functional groups provide a foundation for designing and synthesizing novel compounds with improved pharmacological properties, potentially leading to the discovery of more effective treatments for a range of diseases.
Used in Chemical Synthesis:
In the chemical synthesis industry, (E)-8-(4-(4-bromobutoxy)styryl)-1,3-diethyl-7-methylxanthine can be employed as a starting material or intermediate for the production of other complex organic compounds. Its versatile structure and functional groups make it a valuable building block for creating new molecules with specific properties and applications in various fields, such as materials science, pharmaceuticals, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 155272-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,2,7 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 155272-07:
(8*1)+(7*5)+(6*5)+(5*2)+(4*7)+(3*2)+(2*0)+(1*7)=124
124 % 10 = 4
So 155272-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H27BrN4O3/c1-4-26-20-19(21(28)27(5-2)22(26)29)25(3)18(24-20)13-10-16-8-11-17(12-9-16)30-15-7-6-14-23/h8-13H,4-7,14-15H2,1-3H3/b13-10+