156592-88-0 Usage
Uses
Used in Organic Synthesis:
2’,3’-Di(9-phenylxanthen-9-yl)dithiouridine is used as a key intermediate for the synthesis of complex organic molecules. Its application in this field is due to its unique chemical structure, which allows for the formation of new bonds and the creation of a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2’,3’-Di(9-phenylxanthen-9-yl)dithiouridine is used as a building block for the development of new drugs. Its chemical properties make it a promising candidate for the synthesis of novel therapeutic agents, potentially leading to the discovery of innovative treatments for various diseases and conditions.
Used in Chemical Research:
2’,3’-Di(9-phenylxanthen-9-yl)dithiouridine is also employed in chemical research as a model compound for studying various reaction mechanisms and exploring new synthetic pathways. Its unique structure provides researchers with valuable insights into the behavior of similar compounds and helps in the development of new methodologies in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 156592-88-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,6,5,9 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 156592-88:
(8*1)+(7*5)+(6*6)+(5*5)+(4*9)+(3*2)+(2*8)+(1*8)=170
170 % 10 = 0
So 156592-88-0 is a valid CAS Registry Number.
InChI:InChI=1/C47H36N2O6S2/c50-29-40-42(56-46(30-15-3-1-4-16-30)32-19-7-11-23-36(32)53-37-24-12-8-20-33(37)46)43(44(55-40)49-28-27-41(51)48-45(49)52)57-47(31-17-5-2-6-18-31)34-21-9-13-25-38(34)54-39-26-14-10-22-35(39)47/h1-28,40,42-44,50H,29H2,(H,48,51,52)/t40-,42?,43+,44-/m1/s1
156592-88-0Relevant articles and documents
Synthesis of 2',3'-Dithiouridine
Johnson, Richard,Joshi, Bhalchandra V.,Reese, Colin B.
, p. 133 - 134 (2007/10/02)
The synthesis of 2',3'-dithiouridine 2, starting from uridine, is described.