160068-88-2 Usage
Uses
Used in Applied Chemistry:
4-(1,3,2-Dioxaborinan-2-yl)benzaldehyde is used as a chemical intermediate for reactions involving boron. Its unique structure allows it to participate in various chemical transformations, making it a valuable compound in the field of applied chemistry.
Used in Research:
Currently, 4-(1,3,2-Dioxaborinan-2-yl)benzaldehyde is primarily used for research purposes. Its properties and reactivity are being studied to understand its potential applications in different industries. As research progresses, it may lead to the discovery of new uses for this compound.
Potential Applications:
While 4-(1,3,2-Dioxaborinan-2-yl)benzaldehyde is not typically involved in commercial products or applications at present, more detailed studies and research might reveal potential applications for this compound in various industries. Its unique structure and reactivity could make it a promising candidate for future developments in the fields of materials science, pharmaceuticals, or other areas of applied chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 160068-88-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,0,6 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 160068-88:
(8*1)+(7*6)+(6*0)+(5*0)+(4*6)+(3*8)+(2*8)+(1*8)=122
122 % 10 = 2
So 160068-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BO3/c12-8-9-2-4-10(5-3-9)11-13-6-1-7-14-11/h2-5,8H,1,6-7H2
