162402-37-1 Usage
Uses
Used in Pharmaceutical Industry:
4-(3-Methoxyphenoxy)piperidine is used as a building block for the synthesis of various drugs, particularly antipsychotic and anti-anxiety medications. Its role in the synthesis process is crucial for creating effective medications that can help manage mental health conditions.
Used in Dopamine Receptor Antagonist Research:
4-(3-Methoxyphenoxy)piperidine is used as a potential dopamine receptor antagonist, which means it can block the action of dopamine in the brain. This property has been studied for its potential therapeutic applications in treating conditions related to dopamine imbalances.
Used in Medicine for Sedative and Analgesic Properties:
4-(3-Methoxyphenoxy)piperidine is used for its mild sedative and analgesic properties, making it a versatile compound with potential applications in the field of medicine. Its ability to induce calmness and relieve pain can be beneficial in various medical treatments and interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 162402-37-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,2,4,0 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 162402-37:
(8*1)+(7*6)+(6*2)+(5*4)+(4*0)+(3*2)+(2*3)+(1*7)=101
101 % 10 = 1
So 162402-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO2/c1-14-11-3-2-4-12(9-11)15-10-5-7-13-8-6-10/h2-4,9-10,13H,5-8H2,1H3
