170900-27-3 Usage
Uses
Used in Pharmaceutical Applications:
(3S,5R)-5-[(6R,9R)-6,9-dihydroxy-9-[(2R,5R)-5-[(1R)-1-hydroxypentadecyl]oxolan-2-yl]nonyl]-3-(2-oxopropyl)oxolan-2-one is used as a pharmaceutical compound for its potential therapeutic properties. Its unique molecular structure allows for interactions with various biological targets, which may contribute to the development of new drugs or therapies.
Used in Cosmetic Applications:
In the cosmetics industry, (3S,5R)-5-[(6R,9R)-6,9-dihydroxy-9-[(2R,5R)-5-[(1R)-1-hydroxypentadecyl]oxolan-2-yl]nonyl]-3-(2-oxopropyl)oxolan-2-one is used as an ingredient for its potential benefits to skin health and appearance. Its properties may contribute to moisturization, skin protection, or other cosmetic effects.
Used as a Biochemical Reagent:
(3S,5R)-5-[(6R,9R)-6,9-dihydroxy-9-[(2R,5R)-5-[(1R)-1-hydroxypentadecyl]oxolan-2-yl]nonyl]-3-(2-oxopropyl)oxolan-2-one is used as a biochemical reagent in research and development. Its unique structure and properties make it a valuable tool for studying various biological processes and may aid in the discovery of new bioactive compounds or mechanisms.
Used in Chemical Synthesis:
In the chemical synthesis industry, (3S,5R)-5-[(6R,9R)-6,9-dihydroxy-9-[(2R,5R)-5-[(1R)-1-hydroxypentadecyl]oxolan-2-yl]nonyl]-3-(2-oxopropyl)oxolan-2-one is used as a starting material or intermediate in the synthesis of other complex organic compounds. Its versatile structure allows for further modification and functionalization, leading to the creation of novel molecules with specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 170900-27-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,9,0 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 170900-27:
(8*1)+(7*7)+(6*0)+(5*9)+(4*0)+(3*0)+(2*2)+(1*7)=113
113 % 10 = 3
So 170900-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C35H64O7/c1-3-4-5-6-7-8-9-10-11-12-13-17-20-31(38)33-23-24-34(42-33)32(39)22-21-29(37)18-15-14-16-19-30-26-28(25-27(2)36)35(40)41-30/h28-34,37-39H,3-26H2,1-2H3/t28-,29-,30-,31-,32-,33-,34-/m1/s1