172648-55-4 Usage
Uses
Used in Pharmaceutical Industry:
3-AMINO-2-(METHYLAMINO)-5-(TRIFLUOROMETHYL)PYRIDINE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of biologically active compounds. Its unique structure allows for the creation of molecules with specific therapeutic properties, enhancing the range of treatments available for various medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 3-AMINO-2-(METHYLAMINO)-5-(TRIFLUOROMETHYL)PYRIDINE is utilized as a building block for the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural products. Its role in this industry is crucial for enhancing crop protection and improving agricultural yields.
Used in Medicinal Chemistry Research:
3-AMINO-2-(METHYLAMINO)-5-(TRIFLUOROMETHYL)PYRIDINE is employed as a valuable chemical in medicinal chemistry research for its potential to form the basis of new drug candidates. Its physiological and pharmacological properties make it an attractive compound for exploring novel therapeutic agents and advancing the field of drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 172648-55-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,6,4 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 172648-55:
(8*1)+(7*7)+(6*2)+(5*6)+(4*4)+(3*8)+(2*5)+(1*5)=154
154 % 10 = 4
So 172648-55-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClFN/c6-5-4(7)2-1-3-8-5/h1-3H
172648-55-4Relevant articles and documents
FUSED HETEROCYCLIC COMPOUND AND USE THEREOF
-
Page/Page column 242, (2010/11/17)
A fused heterocyclic compound of formula (1): wherein, A1 and A2 represent a nitrogen atom or the like, R1, R2, R3 and R4 represent a halogen atom or the like, R2 and R3 represent a halogen atom or the like, R5 represents a C1-C6 chain hydrocarbon group optionally substituted with one or more halogen atoms, or the like, R6 and R7 represent a C1-C4 chain hydrocarbon group substituted with one or more halogen atoms, or the like, and n represents 0 or 1, has an excellent noxious arthropod controlling effect.