174079-87-9 Usage
Uses
Used in Organic Synthesis:
(1alpha,4beta[E(trans)]-1-4-[2-(-(-vinylcyclohexyl)ethenyl)ethenyl)ethenyl]-cyclohexyl-4-methoxy-benzol is used as a key intermediate in organic synthesis for the creation of novel compounds with specific properties. Its unique structural features and reactivity make it a valuable building block for the development of new organic molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (1alpha,4beta[E(trans)]-1-4-[2-(-(-vinylcyclohexyl)ethenyl)ethenyl)ethenyl]-cyclohexyl-4-methoxy-benzol is used as a precursor for the synthesis of new drug candidates. Its complex structure and functional groups may contribute to the development of innovative therapeutic agents with unique mechanisms of action and potential for treating various diseases.
Used in Materials Science:
(1alpha,4beta[E(trans)]-1-4-[2-(-(-vinylcyclohexyl)ethenyl)ethenyl)ethenyl]-cyclohexyl-4-methoxy-benzol is utilized in materials science for the development of advanced materials with specific characteristics. Its high degree of unsaturation and unique structural features may be harnessed to create materials with improved properties, such as enhanced stability, reactivity, or selectivity, for use in various applications.
Used in Research and Development:
In research and development, (1alpha,4beta[E(trans)]-1-4-[2-(-(-vinylcyclohexyl)ethenyl)ethenyl)ethenyl]-cyclohexyl-4-methoxy-benzol serves as a subject of study for understanding the properties and potential applications of complex organic molecules. Its unique structure and reactivity provide opportunities for scientists to explore new chemical reactions, mechanisms, and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 174079-87-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,0,7 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 174079-87:
(8*1)+(7*7)+(6*4)+(5*0)+(4*7)+(3*9)+(2*8)+(1*7)=159
159 % 10 = 9
So 174079-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H32O/c1-3-18-4-6-19(7-5-18)8-9-20-10-12-21(13-11-20)22-14-16-23(24-2)17-15-22/h3,8-9,14-21H,1,4-7,10-13H2,2H3/b9-8+/t18-,19-,20-,21-