174132-32-2 Usage
Uses
Used in Pharmaceutical Industry:
1-Pyridin-4-ylethanamine is used as a building block for the synthesis of various pharmaceuticals and organic compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs with diverse therapeutic properties.
Used in Coordination Chemistry:
1-Pyridin-4-ylethanamine is used as a ligand in coordination chemistry. Its ability to form stable complexes with metal ions makes it a useful component in the design and synthesis of coordination compounds with potential applications in catalysis, sensing, and materials science.
Used in Organic Synthesis:
1-Pyridin-4-ylethanamine is used as a reagent in organic synthesis. Its amine functionality can be utilized in various reaction types, such as acylation, alkylation, and condensation reactions, to synthesize a wide range of organic compounds with different functional groups and structural features.
Used in Specialty Chemicals Production:
1-Pyridin-4-ylethanamine is used in the production of specialty chemicals. Its unique properties and reactivity make it a valuable intermediate in the synthesis of various specialty chemicals, such as agrochemicals, dyes, and other fine chemicals, with specific applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 174132-32-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,4,1,3 and 2 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 174132-32:
(8*1)+(7*7)+(6*4)+(5*1)+(4*3)+(3*2)+(2*3)+(1*2)=112
112 % 10 = 2
So 174132-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2.2ClH/c1-6(8)7-2-4-9-5-3-7;;/h2-6H,8H2,1H3;2*1H
