175277-42-6 Usage
Uses
Used in Pharmaceutical Industry:
6-ACETYL-2-MERCAPTONICOTINONITRILE is used as a building block for the synthesis of various pharmaceuticals due to its unique structure and properties. It serves as a key intermediate in the development of new drugs, facilitating the creation of novel therapeutic agents.
Used in Medicinal Chemistry Research:
6-ACETYL-2-MERCAPTONICOTINONITRILE is utilized as a valuable tool in medicinal chemistry research. Its unique structure allows researchers to explore its potential medicinal properties, such as its ability to act as an antiviral and antibacterial agent. This makes it a promising candidate for the development of new treatments for viral and bacterial infections.
Used in Antiviral and Antibacterial Applications:
6-ACETYL-2-MERCAPTONICOTINONITRILE is studied for its potential as an antiviral and antibacterial agent. Its unique structure and properties enable it to target and inhibit the replication of viruses and bacteria, offering a new approach to treating infections and combating antibiotic resistance.
Used in Neurological Disorder Treatment:
6-ACETYL-2-MERCAPTONICOTINONITRILE has been investigated for its potential use in the treatment of neurological disorders. Its unique properties may offer new avenues for the development of therapies to address various neurological conditions, improving patient outcomes and quality of life.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-42-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175277-42:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*4)+(1*2)=156
156 % 10 = 6
So 175277-42-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2OS/c1-5(11)7-3-2-6(4-9)8(12)10-7/h2-3H,1H3,(H,10,12)
