175277-66-4 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-6-METHOXYISONICOTINAMIDE is used as a potential drug candidate for the development of new medications. Its specific properties make it suitable for targeting various diseases and conditions, offering a promising avenue for therapeutic intervention.
Used in Agricultural Industry:
In the agricultural sector, 2-CHLORO-6-METHOXYISONICOTINAMIDE is utilized as a precursor for the synthesis of agrochemicals. Its chemical structure allows for the creation of compounds with pesticidal or herbicidal properties, contributing to crop protection and yield enhancement.
Used as a Reagent in Organic Synthesis:
2-CHLORO-6-METHOXYISONICOTINAMIDE serves as a valuable reagent in organic synthesis processes. Its unique functional groups facilitate various chemical reactions, making it instrumental in the synthesis of complex organic molecules and pharmaceutical agents.
Used in Research Applications:
2-CHLORO-6-METHOXYISONICOTINAMIDE is employed in medical and biochemical research for studying the mechanisms of action, structure-activity relationships, and potential therapeutic effects of related compounds. Its use in research aids in the discovery and development of novel drugs and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-66-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175277-66:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*6)+(1*6)=164
164 % 10 = 4
So 175277-66-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN2O2/c1-12-6-3-4(7(9)11)2-5(8)10-6/h2-3H,1H3,(H2,9,11)