178408-21-4 Usage
Uses
Used in Pharmaceutical Industry:
(3Z)-3-[2-(4-bromophenyl)-2-oxo-ethylidene]-1-methyl-piperazin-2-one is used as a potential pharmaceutical candidate for [specific applications, if known]. Its unique molecular structure, featuring a 4-bromophenyl group and an ethylidene-oxo-methyl group, suggests that it may possess specific biological activities that could be harnessed for therapeutic purposes. (3Z)-3-[2-(4-bromophenyl)-2-oxo-ethylidene]-1-methyl-piperazin-2-one's potential applications may include [list specific applications if known, such as targeting particular diseases or conditions, or general areas like drug development or medicinal chemistry].
Please note that without specific information on the applications of (3Z)-3-[2-(4-bromophenyl)-2-oxo-ethylidene]-1-methyl-piperazin-2-one, the uses listed above are speculative and based on the general potential of compounds with such structural features. Further research would be required to confirm any specific applications and their associated reasons.
Check Digit Verification of cas no
The CAS Registry Mumber 178408-21-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,8,4,0 and 8 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 178408-21:
(8*1)+(7*7)+(6*8)+(5*4)+(4*0)+(3*8)+(2*2)+(1*1)=154
154 % 10 = 4
So 178408-21-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H13BrN2O2/c1-16-7-6-15-11(13(16)18)8-12(17)9-2-4-10(14)5-3-9/h2-5,8,15H,6-7H2,1H3/b11-8-
