179951-64-5 Usage
Uses
Used in Organic Synthesis:
(3E)-2-amino-4-(5-nitrothiophen-2-yl)buta-1,3-diene-1,1,3-tricarbonitrile is used as a synthetic intermediate for the creation of more complex organic compounds. Its unique structure and functional groups make it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Development:
In the pharmaceutical industry, (3E)-2-amino-4-(5-nitrothiophen-2-yl)buta-1,3-diene-1,1,3-tricarbonitrile is used as a key component in the development of new drugs. Its structural features and functional groups can be leveraged to design molecules with specific biological activities, potentially leading to the discovery of novel therapeutic agents.
Used in Materials Science:
(3E)-2-amino-4-(5-nitrothiophen-2-yl)buta-1,3-diene-1,1,3-tricarbonitrile may also find applications in materials science, where its unique structure and properties can be utilized to develop new materials with specialized characteristics. These could include advanced polymers, sensors, or other innovative materials with applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 179951-64-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,9,5 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 179951-64:
(8*1)+(7*7)+(6*9)+(5*9)+(4*5)+(3*1)+(2*6)+(1*4)=195
195 % 10 = 5
So 179951-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H5N5O2S/c12-4-7(11(15)8(5-13)6-14)3-9-1-2-10(19-9)16(17)18/h1-3H,15H2/b7-3-
