180403-26-3 Usage
Uses
Used in Organic Synthesis:
Thiourea,N-[2-(2-pyridinyl)ethyl]is used as a reagent in organic synthesis for its capacity to form complexes with metal ions, which can facilitate various chemical reactions and improve the efficiency of synthesis processes.
Used in Coordination Chemistry:
In coordination chemistry, Thiourea,N-[2-(2-pyridinyl)ethyl]is used as a ligand due to its ability to chelate metal ions, which is crucial for the formation and stabilization of metal complexes.
Used in Medicinal Chemistry:
Thiourea,N-[2-(2-pyridinyl)ethyl]may be utilized in medicinal chemistry for its potential role in the development of pharmaceuticals, given its ability to interact with metal ions and its structural features.
Used in Pharmaceutical Production:
Thiourea,N-[2-(2-pyridinyl)ethyl]is used in the production of pharmaceuticals, where its metal-ion binding properties could contribute to the creation of new drug candidates or improve the efficacy of existing medications.
Used in Dye Production:
Thiourea,N-[2-(2-pyridinyl)ethyl]is also used in the production of dyes, where its chemical structure can impart specific color characteristics and properties to the dyes.
Used as a Catalyst in Organic Reactions:
In the realm of catalysis, Thiourea,N-[2-(2-pyridinyl)ethyl]is employed to accelerate organic reactions, potentially improving the speed and yield of chemical processes in industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 180403-26-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,4,0 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 180403-26:
(8*1)+(7*8)+(6*0)+(5*4)+(4*0)+(3*3)+(2*2)+(1*6)=103
103 % 10 = 3
So 180403-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3S/c9-8(12)11-6-4-7-3-1-2-5-10-7/h1-3,5H,4,6H2,(H3,9,11,12)
