190004-53-6 Usage
Uses
Used in Pharmaceutical Industry:
CBZ-1-AMINO-1-CYCLOBUTANECARBOXYLIC ACID is used as a key intermediate for the synthesis of cyclobutane-containing drugs. Its presence in the molecular structure of these drugs allows for the exploration of new therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Organic Synthesis:
CBZ-1-AMINO-1-CYCLOBUTANECARBOXYLIC ACID is used as a starting material for the preparation of various organic compounds. Its functional groups enable it to participate in a wide array of chemical reactions, facilitating the creation of new molecules with diverse properties and applications.
Used in Research and Development:
In the field of chemical research, CBZ-1-AMINO-1-CYCLOBUTANECARBOXYLIC ACID is utilized as a valuable tool for studying the properties and reactivity of cyclobutane derivatives. Its unique structure allows researchers to investigate new synthetic pathways and explore the potential of this class of compounds in various applications.
Used in Industrial Applications:
Beyond its pharmaceutical relevance, CBZ-1-AMINO-1-CYCLOBUTANECARBOXYLIC ACID also finds use in various industrial processes. Its ability to form a variety of compounds makes it a valuable component in the development of new materials, catalysts, and other specialty chemicals that can be employed across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 190004-53-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,0,0,0 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 190004-53:
(8*1)+(7*9)+(6*0)+(5*0)+(4*0)+(3*4)+(2*5)+(1*3)=96
96 % 10 = 6
So 190004-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO4/c15-11(16)13(7-4-8-13)14-12(17)18-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,14,17)(H,15,16)
