192804-36-7 Usage
Uses
Used in Organic Synthesis:
(4-CBZ-AMINOPHENYL)BORONIC ACID is used as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds in organic synthesis. Its ability to selectively form these bonds contributes to the synthesis of complex organic molecules with high efficiency and specificity.
Used in Pharmaceutical Development:
In the pharmaceutical industry, (4-CBZ-AMINOPHENYL)BORONIC ACID is utilized as a key intermediate in the synthesis of various drug candidates. Its capacity to selectively bind to specific biological targets allows for the development of targeted therapies with improved efficacy and reduced side effects.
Used in Agrochemical Development:
Similarly, in agrochemicals, (4-CBZ-AMINOPHENYL)BORONIC ACID serves as a building block for the creation of novel compounds with specific pesticidal or herbicidal properties. Its selective binding characteristics enable the design of more effective and environmentally friendly agrochemicals.
Used in Materials Science:
(4-CBZ-AMINOPHENYL)BORONIC ACID is also applied in the field of materials science, particularly in the development of functional polymers and supramolecular materials. Its incorporation into these materials can impart unique properties, such as self-assembly capabilities, responsiveness to stimuli, or enhanced mechanical characteristics, broadening the scope of materials available for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 192804-36-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,2,8,0 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 192804-36:
(8*1)+(7*9)+(6*2)+(5*8)+(4*0)+(3*4)+(2*3)+(1*6)=147
147 % 10 = 7
So 192804-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H14BNO4/c17-14(20-10-11-4-2-1-3-5-11)16-13-8-6-12(7-9-13)15(18)19/h1-9,18-19H,10H2,(H,16,17)
