19741-46-9 Usage
Uses
6-Hydroxyhetisan-11-one is used as a pharmaceutical compound for its potential therapeutic applications.
Used in Pharmaceutical Industry:
6-Hydroxyhetisan-11-one is used as a bioactive compound for its potential medicinal properties. It can be further studied and developed for various therapeutic applications, such as the treatment of diseases or disorders, based on its unique chemical structure and properties.
References
Goto et al., Tetrahedron Lett., 1369 (1968)
Check Digit Verification of cas no
The CAS Registry Mumber 19741-46-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,4 and 1 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19741-46:
(7*1)+(6*9)+(5*7)+(4*4)+(3*1)+(2*4)+(1*6)=129
129 % 10 = 9
So 19741-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H25NO2/c1-10-7-18-8-20(23)16-17(2)4-3-5-19(16)14(18)13(22)11(10)6-12(18)15(19)21(20)9-17/h11-12,14-16,23H,1,3-9H2,2H3/t11-,12?,14-,15?,16-,17+,18+,19+,20+/m1/s1