205518-89-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Ethylpyrimidine-5-carbaldehyde is used as an intermediate for the synthesis of various pharmaceuticals, leveraging its chemical properties to contribute to the development of new drugs.
Used in Agrochemical Production:
In the agrochemical industry, 2-Ethylpyrimidine-5-carbaldehyde serves as a key intermediate, playing a crucial role in the creation of compounds designed to protect crops and enhance agricultural productivity.
Used in Organic Chemistry as a Building Block:
2-Ethylpyrimidine-5-carbaldehyde is utilized as a versatile building block in organic chemistry for the preparation of a wide array of heterocyclic compounds, which are essential in various chemical and pharmaceutical applications.
Used in Material Development:
2-Ethylpyrimidine-5-carbaldehyde is also used in the development of new materials, capitalizing on its unique structural attributes to create innovative substances with potential applications in diverse fields.
Used in Research Applications:
2-Ethylpyrimidine-5-carbaldehyde is employed in various research areas, serving as a starting material for exploring new chemical reactions and mechanisms, thereby contributing to the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 205518-89-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,5,1 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 205518-89:
(8*2)+(7*0)+(6*5)+(5*5)+(4*1)+(3*8)+(2*8)+(1*9)=124
124 % 10 = 4
So 205518-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O/c1-2-7-8-3-6(5-10)4-9-7/h3-5H,2H2,1H3
