223433-45-2 Usage
Uses
Used in Organic Chemistry:
2-(Morpholin-4-ylmethyl)benzeneboronic acid is used as a building block for the synthesis of various pharmaceuticals, agrochemicals, and materials. Its presence in these compounds contributes to their structural and functional diversity, enhancing their performance and effectiveness.
Used in Transition Metal-Catalyzed Cross-Coupling Reactions:
As a ligand, 2-(Morpholin-4-ylmethyl)benzeneboronic acid is utilized in transition metal-catalyzed cross-coupling reactions. It plays a crucial role in facilitating the formation of carbon-carbon bonds, which are essential for the synthesis of complex organic molecules.
Used in Sensor and Probe Development:
2-(Morpholin-4-ylmethyl)benzeneboronic acid is used as a component in the development of sensors and probes for carbohydrate recognition and other biological applications. Its boronic acid functionality allows it to form reversible covalent bonds with diols and other nucleophiles, making it a valuable tool for detecting and analyzing specific biomolecules.
Check Digit Verification of cas no
The CAS Registry Mumber 223433-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,4,3 and 3 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 223433-45:
(8*2)+(7*2)+(6*3)+(5*4)+(4*3)+(3*3)+(2*4)+(1*5)=102
102 % 10 = 2
So 223433-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H16BNO3/c14-12(15)11-4-2-1-3-10(11)9-13-5-7-16-8-6-13/h1-4,14-15H,5-9H2
