227203-36-3 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 1-AMINOMETHYL-CYCLOHEXANECARBOXYLATE HCL is used as a key intermediate in the synthesis of various medications. Its unique chemical structure allows it to be incorporated into the molecular frameworks of different pharmaceutical compounds, contributing to their therapeutic properties and efficacy.
Used in Agrochemical Production:
In the agrochemical industry, METHYL 1-AMINOMETHYL-CYCLOHEXANECARBOXYLATE HCL is utilized in the production of insecticides and other agricultural chemicals. Its chemical properties make it suitable for the development of effective pest control agents, helping to protect crops and enhance agricultural productivity.
Overall, METHYL 1-AMINOMETHYL-CYCLOHEXANECARBOXYLATE HCL plays a significant role in both the pharmaceutical and agrochemical industries, serving as a crucial building block for the creation of various beneficial products. Its versatility and solubility properties make it an essential component in the synthesis processes of a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 227203-36-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,7,2,0 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 227203-36:
(8*2)+(7*2)+(6*7)+(5*2)+(4*0)+(3*3)+(2*3)+(1*6)=103
103 % 10 = 3
So 227203-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H17NO2.ClH/c1-12-8(11)9(7-10)5-3-2-4-6-9;/h2-7,10H2,1H3;1H
