235088-67-2 Usage
Uses
Used in Chemical Research:
2,3,4-Trifluorobenzylamine is used as a chemical intermediate for the synthesis of various complex molecules and compounds. Its unique structure, with fluorine atoms on the benzyl group, provides distinct reactivity and properties that can be exploited in the development of new chemical entities.
Used in Pharmaceutical Industry:
2,3,4-Trifluorobenzylamine is used as a building block in the design and synthesis of new pharmaceutical compounds. Its fluorinated benzylamine structure can contribute to the modification of drug properties, such as solubility, stability, and bioavailability, potentially leading to improved therapeutic effects.
Used in Material Science:
2,3,4-Trifluorobenzylamine is used as a component in the development of new materials with specific properties, such as enhanced thermal stability, chemical resistance, or electronic properties. Its incorporation into polymers or other materials can lead to novel applications in various industries.
Used in Agrochemical Industry:
2,3,4-Trifluorobenzylamine is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical structure can contribute to the development of more effective and environmentally friendly agrochemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 235088-67-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,5,0,8 and 8 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 235088-67:
(8*2)+(7*3)+(6*5)+(5*0)+(4*8)+(3*8)+(2*6)+(1*7)=142
142 % 10 = 2
So 235088-67-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F3N/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2H,3,11H2
235088-67-2Relevant articles and documents
The pattern of fluorine substitution affects binding affinity in a small library of fluoroaromatic inhibitors for carbonic anhydrase
Doyon, Jeffrey B.,Jain, Ahamindra
, p. 183 - 185 (2008/02/11)
(equation presented) A library of fluoroaromatic inhibitors of carbonic anhydrase has been found to bind in a manner dependent on both hydrophobicity and the pattern of substitution of the fluoroaromatic ring. All of the compounds in the library bind to the protein with Kd 3 nM. We have inferred two distinct binding modes from our data, which suggest two types of interactions that should be considered when designing fluorinated drugs.
