259683-56-2 Usage
Uses
Used in Chemical Synthesis:
1-(2-FORMYLPHENYL)PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER is used as an intermediate compound for the synthesis of other complex organic molecules. Its unique structure allows for further chemical reactions and modifications, making it a valuable component in the creation of new compounds with potential applications in various fields.
Used in Laboratory Research:
In the field of scientific research, 1-(2-FORMYLPHENYL)PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER is used as a research chemical to study its properties and potential interactions with other compounds. This can lead to a better understanding of its reactivity and possible applications in various chemical processes.
Used in Pharmaceutical Industry:
1-(2-FORMYLPHENYL)PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER is used as a building block in the development of new pharmaceutical compounds. Its structure may contribute to the creation of novel drugs with potential therapeutic applications, such as in the treatment of various diseases and medical conditions.
Used in Industrial Applications:
In the industrial sector, 1-(2-FORMYLPHENYL)PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER may be used in the production of specialty chemicals, materials, or other products. Its unique properties could be harnessed to improve the performance or characteristics of these products, leading to advancements in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 259683-56-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,9,6,8 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 259683-56:
(8*2)+(7*5)+(6*9)+(5*6)+(4*8)+(3*3)+(2*5)+(1*6)=192
192 % 10 = 2
So 259683-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO3/c1-2-19-15(18)12-7-9-16(10-8-12)14-6-4-3-5-13(14)11-17/h3-6,11-12H,2,7-10H2,1H3
259683-56-2Relevant articles and documents
NOVEL IMIDAZOLE COMPOUND AND USE THEREOF AS MELANOCORTIN RECEPTOR AGONIST
-
Paragraph 0502, (2018/10/04)
The present invention relates to a novel imidazole compound or a pharmaceutically acceptable salt thereof having a melanocortin receptor agonistic activity, and medical use thereof. The present invention relates to an imidazole compound represented by general formula [I] [wherein: Ring A represents an optionally substituted aryl group or the like; R1 represents a hydrogen atom, an optionally substituted alkyl group, or the like; R2 represents a hydrogen atom, a halogen atom, or the like; and R3 represents an optionally substituted alkyl group] or a pharmaceutically acceptable salt thereof.
Pharmaceutical compositions (by machine translation)
-
Paragraph 0175, (2019/01/31)
[Problem] imidazole compound or its pharmacologically acceptable salt in the melanocortin receptor activity that operates as an active ingredient of a pharmaceutical composition comprising. "I" general formula [a]" Formula, the aryl group may be substituted A ring represents a; R1 Represents a hydrogen atom, or an alkyl group which may be substituted represented; R2 Represents a hydrogen atom, a halogen atom or represents a; R3 The alkyl group may be substituted " represented by the imidazole compound, its pharmacologically acceptable salt as an active ingredient in a pharmaceutical composition. [Drawing] no (by machine translation)
