260369-10-6 Usage
Uses
Used in Pharmaceutical Industry:
Tetrahydrofuran-3-boronic acid is used as a building block for the synthesis of complex organic molecules, particularly in the development of pharmaceuticals. Its unique structure and reactivity facilitate the formation of biaryl and heteroaryl compounds through Suzuki-Miyaura cross-couplings, which are crucial for the creation of novel drug candidates with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, Tetrahydrofuran-3-boronic acid is employed as a key intermediate in the synthesis of agrochemicals. Its ability to form carbon-carbon and carbon-heteroatom bonds makes it an essential component in the development of new pesticides, herbicides, and other agrochemicals with enhanced efficacy and selectivity.
Used in Organic Synthesis:
Tetrahydrofuran-3-boronic acid is utilized as a versatile reagent in organic synthesis for the formation of various carbon-carbon and carbon-heteroatom bonds. Its unique structure and reactivity make it a valuable tool for the synthesis of complex organic molecules, including natural products, pharmaceuticals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 260369-10-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,0,3,6 and 9 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 260369-10:
(8*2)+(7*6)+(6*0)+(5*3)+(4*6)+(3*9)+(2*1)+(1*0)=126
126 % 10 = 6
So 260369-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H9BO3/c6-5(7)4-1-2-8-3-4/h4,6-7H,1-3H2
