261951-68-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Fluoro-3-methylbenzylamine is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with specific therapeutic properties. Its unique structure allows for the creation of molecules with tailored pharmacological activities.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Fluoro-3-methylbenzylamine is employed as a precursor in the production of agrochemicals, such as pesticides and herbicides, where its chemical structure can enhance the effectiveness and selectivity of these compounds in agricultural applications.
Used in Organic Synthesis:
4-Fluoro-3-methylbenzylamine is utilized as a building block in organic synthesis, allowing for the creation of novel organic compounds with potential applications in various industries, including materials science, chemical research, and specialty chemicals manufacturing.
Used in Research and Development:
As a chemical compound with unique structural features, 4-Fluoro-3-methylbenzylamine is used in research and development for exploring its potential in the synthesis of new compounds and understanding its reactivity and properties in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 261951-68-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,1,9,5 and 1 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 261951-68:
(8*2)+(7*6)+(6*1)+(5*9)+(4*5)+(3*1)+(2*6)+(1*8)=152
152 % 10 = 2
So 261951-68-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10FN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,5,10H2,1H3
