269398-94-9 Usage
Uses
Used in Pharmaceutical Industry:
Fmoc-(R)-3-Amino-4-(pentafluoro-phenyl)-butyric acid is used as a building block for peptide synthesis, contributing to the development of peptide-based drugs. Its hydrophobicity and stability, conferred by the pentafluoro-phenyl group, are advantageous for the design of therapeutic agents that require specific physicochemical properties.
Used in Biotechnology Industry:
In the biotechnology sector, Fmoc-(R)-3-Amino-4-(pentafluoro-phenyl)-butyric acid is utilized as a component in the engineering of biomaterials and the synthesis of peptides with specific functions. The Fmoc protecting group plays a crucial role in the synthesis process by ensuring that the amino acid remains unreactive until it is precisely positioned within the growing peptide chain during solid-phase synthesis.
These applications underscore the compound's versatility and importance in the fields of pharmaceuticals and biotechnology, where its unique properties can be harnessed to create innovative solutions for various medical and biological challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-94-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 269398-94:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*9)+(1*4)=209
209 % 10 = 9
So 269398-94-9 is a valid CAS Registry Number.
InChI:InChI=1/C25H18F5NO4/c26-20-17(21(27)23(29)24(30)22(20)28)9-12(10-19(32)33)31-25(34)35-11-18-15-7-3-1-5-13(15)14-6-2-4-8-16(14)18/h1-8,12,18H,9-11H2,(H,31,34)(H,32,33)/t12-/m1/s1