269726-87-6 Usage
Uses
Used in Pharmaceutical Industry:
Fmoc-(R)-3-Amino-4-(4-cyano-phenyl)-butyric acid serves as a crucial building block in the synthesis of peptide-based drugs and pharmaceuticals. Its incorporation allows for the development of novel therapeutic agents with specific biological activities, contributing to advancements in medicinal chemistry.
Used in Chemical Research:
As a versatile and functionalized amino acid derivative, Fmoc-(R)-3-Amino-4-(4-cyano-phenyl)-butyric acid is highly valuable in chemical research. It enables the exploration of new chemical reactions and the synthesis of complex organic molecules, broadening the scope of chemical synthesis and discovery.
Used in Biochemical Research:
Fmoc-(R)-3-Amino-4-(4-cyano-phenyl)-butyric acid also finds application in biochemical research, where it aids in the study of protein structure and function. Its unique side chain can influence the properties of the peptides it is a part of, providing insights into protein-ligand interactions and other biochemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 269726-87-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,7,2 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 269726-87:
(8*2)+(7*6)+(6*9)+(5*7)+(4*2)+(3*6)+(2*8)+(1*7)=196
196 % 10 = 6
So 269726-87-6 is a valid CAS Registry Number.
InChI:InChI=1/C26H22N2O4/c27-15-18-11-9-17(10-12-18)13-19(14-25(29)30)28-26(31)32-16-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-12,19,24H,13-14,16H2,(H,28,31)(H,29,30)/t19-/m1/s1