270063-41-7 Usage
Uses
Used in Organic Synthesis:
(s)-3-amino-4-pentafluorophenylbutanoic acid hydrochloride is used as a building block in organic synthesis for the creation of various pharmaceuticals and bioactive compounds. Its unique properties and pentafluorophenyl group contribute to the development of new chemical entities with potential therapeutic applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (s)-3-amino-4-pentafluorophenylbutanoic acid hydrochloride serves as a valuable intermediate in the synthesis of drug candidates. Its presence in the molecular structure can impart specific biological activities, making it a promising component in the discovery and development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 270063-41-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 3 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 270063-41:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*3)+(2*4)+(1*1)=107
107 % 10 = 7
So 270063-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8F5NO2.ClH/c11-6-4(1-3(16)2-5(17)18)7(12)9(14)10(15)8(6)13;/h3H,1-2,16H2,(H,17,18);1H/t3-;/m0./s1