307496-33-9 Usage
Uses
Used in Chemical Synthesis:
2,6-Difluorobenzylzinc bromide is used as a reagent in chemical synthesis for its ability to participate in coupling and catalytic reactions. Its presence can enhance the efficiency of the synthesis process, making it a valuable component in the production of various chemical compounds.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 2,6-Difluorobenzylzinc bromide is used as a key intermediate in the synthesis of certain drugs. Its role in facilitating chemical reactions allows for the creation of complex molecules that are otherwise difficult to produce, contributing to the development of new and improved medications.
Used in Research and Development:
2,6-Difluorobenzylzinc bromide is employed as a research tool in the exploration of new chemical pathways and reaction mechanisms. Its unique properties make it an interesting subject for study, potentially leading to the discovery of novel applications and advancements in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 307496-33-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,7,4,9 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 307496-33:
(8*3)+(7*0)+(6*7)+(5*4)+(4*9)+(3*6)+(2*3)+(1*3)=149
149 % 10 = 9
So 307496-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F2.BrH.Zn/c1-5-6(8)3-2-4-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5BrF2Zn/c8-11-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2
307496-33-9Relevant articles and documents
COMPOUNDS, COMPOSITIONS AND METHODS FOR HISTONE LYSINE DEMETHYLASE INHIBITION
-
Paragraph 0257; 0324, (2022/03/09)
The present disclosure relates generally to compounds and pharmaceutical compositions for the selective inhibition of histone lysine demethylase5 (KDM5), particularly KDM5B, and methods of their use in treating conditions and diseases associated with KDM5 activity.