312693-01-9 Usage
Uses
Used in Organic Synthesis:
6-Ethoxy-6-oxohexylzinc bromide is utilized as a reagent for its ability to effectively participate in carbon-carbon bond formation reactions, which are fundamental in constructing complex organic molecules.
Used in Cross-Coupling Reactions:
In the field of organic chemistry, 6-ethoxy-6-oxohexylzinc bromide is employed as a component in cross-coupling reactions, such as the Negishi coupling. Its application in these reactions contributes to the synthesis of intricate organic molecules that are valuable in various chemical and pharmaceutical processes.
Used as a Nucleophile:
6-Ethoxy-6-oxohexylzinc bromide also serves as a nucleophile, engaging in reactions with a range of electrophiles. This capability allows it to form new carbon-carbon bonds, further expanding its utility in organic chemistry for the creation of complex molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 312693-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,9 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 312693-01:
(8*3)+(7*1)+(6*2)+(5*6)+(4*9)+(3*3)+(2*0)+(1*1)=119
119 % 10 = 9
So 312693-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H15O2.BrH.Zn/c1-3-5-6-7-8(9)10-4-2;;/h1,3-7H2,2H3;1H;/q-1;;+2/p-1/rC8H15O2.BrZn/c1-3-5-6-7-8(9)10-4-2;1-2/h1,3-7H2,2H3;/q-1;+1
