312693-53-1 Usage
Uses
Used in Pharmaceutical Industry:
8-Amino-6-methoxyquinoline hydrobromide is used as an amino component in the development of novel bladder-selective diaminocyclobutenedione potassium channel openers. These compounds have potential therapeutic applications in treating conditions related to bladder dysfunction, such as overactive bladder syndrome.
Used in Organic Synthesis:
8-Amino-6-methoxyquinoline hydrobromide is also used for the synthesis of 1-N-(6-methoxy-8-quinoyl)-4′-carboxyl-benzensulfonamide, a compound that may have potential applications in various fields, such as pharmaceuticals, agrochemicals, or materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 312693-53-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,9 and 3 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 312693-53:
(8*3)+(7*1)+(6*2)+(5*6)+(4*9)+(3*3)+(2*5)+(1*3)=131
131 % 10 = 1
So 312693-53-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O.BrH/c1-13-8-5-7-3-2-4-12-10(7)9(11)6-8;/h2-6H,11H2,1H3;1H
