313471-13-5 Usage
Uses
Used in Pharmaceutical Industry:
2-(6-OXO-7,8,9,10-TETRAHYDRO-6H-BENZO[C]CHROMEN-3-YLOXY)-PROPIONIC ACID is used as a building block for the synthesis of other molecules with similar structures for potential pharmaceutical applications. Its unique chemical composition may contribute to the development of new drugs with specific therapeutic effects.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-(6-OXO-7,8,9,10-TETRAHYDRO-6H-BENZO[C]CHROMEN-3-YLOXY)-PROPIONIC ACID is used for studying its potential biological activity and physiological effects. Understanding these properties can lead to insights into its possible use in treating various medical conditions or as a component in drug formulations.
Used in Chemical Synthesis:
2-(6-OXO-7,8,9,10-TETRAHYDRO-6H-BENZO[C]CHROMEN-3-YLOXY)-PROPIONIC ACID is utilized as a key intermediate in the synthesis of complex organic compounds. Its unique structure allows for the creation of a variety of chemical entities that may have applications in different industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 313471-13-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,3,4,7 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 313471-13:
(8*3)+(7*1)+(6*3)+(5*4)+(4*7)+(3*1)+(2*1)+(1*3)=105
105 % 10 = 5
So 313471-13-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H16O5/c1-9(15(17)18)20-10-6-7-12-11-4-2-3-5-13(11)16(19)21-14(12)8-10/h6-9H,2-5H2,1H3,(H,17,18)
