313961-68-1 Usage
Uses
Used in Pharmaceutical Industry:
6-FLUORO-2-(METHYLAMINO)-4(1H)-PYRIMIDINONE is used as a chemical intermediate for the development of new drugs and medications. Its unique structure and potential biological activity make it a valuable component in the creation of innovative pharmaceutical products.
Used in Organic Synthesis:
6-FLUORO-2-(METHYLAMINO)-4(1H)-PYRIMIDINONE is used as a building block in the synthesis of various organic compounds. Its presence of a fluorine atom and a methylamino group allows for versatile chemical reactions, contributing to the formation of a wide range of molecules with different properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 313961-68-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,3,9,6 and 1 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 313961-68:
(8*3)+(7*1)+(6*3)+(5*9)+(4*6)+(3*1)+(2*6)+(1*8)=141
141 % 10 = 1
So 313961-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H6FN3O/c1-7-5-8-3(6)2-4(10)9-5/h2H,1H3,(H2,7,8,9,10)
