33564-64-6 Usage
Uses
Used in Chemical Synthesis:
3-Bromo-2,4,5-trifluorobenzoic acid is used as a key intermediate in the synthesis of various organic compounds. Its unique atomic arrangement and the presence of bromine and fluorine atoms contribute to its reactivity and versatility in organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Bromo-2,4,5-trifluorobenzoic acid is used as a building block for the development of new drugs. Its strong acidic properties and distinctive chemical characteristics make it suitable for the synthesis of various pharmaceutical compounds.
Used in Material Science:
3-Bromo-2,4,5-trifluorobenzoic acid is also utilized in material science for the development of new materials with specific properties. Its unique structure and chemical properties can be exploited to create materials with tailored characteristics for various applications.
Used in Research and Development:
3-Bromo-2,4,5-trifluorobenzoic acid is employed in research and development for the exploration of new chemical reactions and processes. Its distinctive properties make it an interesting subject for scientific studies and the development of innovative applications.
Check Digit Verification of cas no
The CAS Registry Mumber 33564-64-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,5,6 and 4 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 33564-64:
(7*3)+(6*3)+(5*5)+(4*6)+(3*4)+(2*6)+(1*4)=116
116 % 10 = 6
So 33564-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H2BrF3O2/c8-4-5(10)2(7(12)13)1-3(9)6(4)11/h1H,(H,12,13)
