336115-72-1 Usage
Uses
Used in Pharmaceutical Industry:
N-[1-(3-Benzyl-7-chloro-4-oxo-3,4-dihydro-quinazolin-2-yl)-propyl]-4-bromo-N-(3-dimethylamino-propyl)-benzamide is used as a potential therapeutic agent for various conditions due to its complex molecular structure and the presence of multiple functional groups that may contribute to its pharmacological activity. N-[1-(3-Benzyl-7-chloro-4-oxo-3,4-dihydro-quinazolin-2-yl)-propyl]-4-bromo-N-(3-dimethylamino-propyl)-benzamide's potential applications include antipsychotic, anticonvulsant, or antihypertensive treatments, although its specific uses would require further investigation and clinical trials to establish safety and efficacy.
Used in Research and Development:
In the field of medicinal chemistry and drug discovery, N-[1-(3-Benzyl-7-chloro-4-oxo-3,4-dihydro-quinazolin-2-yl)-propyl]-4-bromo-N-(3-dimethylamino-propyl)-benzamide serves as a valuable compound for research purposes. It can be used to study the effects of its various functional groups on biological activity, potentially leading to the development of new drugs with improved efficacy and reduced side effects. Additionally, the compound may be utilized in the design and synthesis of novel pharmaceutical agents targeting specific diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 336115-72-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,6,1,1 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 336115-72:
(8*3)+(7*3)+(6*6)+(5*1)+(4*1)+(3*5)+(2*7)+(1*2)=121
121 % 10 = 1
So 336115-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C30H32BrClN4O2/c1-4-27(35(18-8-17-34(2)3)29(37)22-11-13-23(31)14-12-22)28-33-26-19-24(32)15-16-25(26)30(38)36(28)20-21-9-6-5-7-10-21/h5-7,9-16,19,27H,4,8,17-18,20H2,1-3H3