349090-42-2 Usage
Uses
Used in Chemical Synthesis:
1-(3-chloropropanoyl)-4-methylpiperidine is used as a building block in chemical synthesis for its ability to contribute to the formation of a wide range of organic compounds. Its unique structure allows it to be a key component in the development of new chemical entities.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-(3-chloropropanoyl)-4-methylpiperidine is used as an intermediate in the production of various pharmaceuticals. Its chemical structure makes it an important component in the synthesis of drugs, potentially contributing to the development of new medications.
Used in Agrochemical Production:
1-(3-chloropropanoyl)-4-methylpiperidine also finds application in the agrochemical sector, where it serves as an intermediate for the synthesis of various agrochemicals. Its role in this industry is crucial for the development of effective products for agricultural use.
Used in Research:
1-(3-chloropropanoyl)-4-methylpiperidine is utilized in research settings to explore its chemical properties and potential applications. Researchers may investigate its reactivity, stability, and how it can be modified or combined with other chemicals to create new compounds with specific uses.
Check Digit Verification of cas no
The CAS Registry Mumber 349090-42-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,9,0,9 and 0 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 349090-42:
(8*3)+(7*4)+(6*9)+(5*0)+(4*9)+(3*0)+(2*4)+(1*2)=152
152 % 10 = 2
So 349090-42-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H16ClNO/c1-8-3-6-11(7-4-8)9(12)2-5-10/h8H,2-7H2,1H3
