351003-47-9 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-3-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE is used as a versatile intermediate for the synthesis of various pharmaceuticals. Its functional groups enable the introduction of specific functionalities into target molecules, facilitating the development of new drugs with desired properties.
Used in Agrochemical Industry:
In the agrochemical industry, 4-BROMO-3-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE is utilized as a key intermediate in the production of agrochemicals. Its unique functional groups contribute to the creation of effective and targeted agrochemicals for crop protection and other agricultural applications.
Used in Fine Chemicals Industry:
4-BROMO-3-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE is employed as a valuable building block in the synthesis of complex organic molecules for the fine chemicals industry. Its presence in the molecular structure allows for the development of high-quality specialty chemicals with specific applications in various fields.
Used in Organic Synthesis:
As a reagent in organic synthesis, 4-BROMO-3-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE is used for introducing bromine, trifluoromethyl, and sulfonyl chloride functional groups into target molecules. This capability is essential for the synthesis of a wide range of organic compounds with diverse applications.
Used in Research and Development:
4-BROMO-3-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE is also utilized in research and development settings for exploring new chemical reactions and synthesizing novel compounds. Its unique properties make it a valuable tool for advancing scientific knowledge and discovering new applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 351003-47-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,1,0,0 and 3 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 351003-47:
(8*3)+(7*5)+(6*1)+(5*0)+(4*0)+(3*3)+(2*4)+(1*7)=89
89 % 10 = 9
So 351003-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N/c1-11(2)8-7-9-5-3-4-6-10(9)12-11/h3-6,12H,7-8H2,1-2H3