352208-42-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-Methoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid is used as an intermediate in the synthesis of pharmaceuticals for its potential medicinal properties and ability to be incorporated into new drug development.
Used in Research Chemicals:
1-(2-Methoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid is used as a research chemical to study its potential applications and effects in various fields, including medicinal chemistry and drug discovery. Further research is needed to fully understand its potential uses and benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 352208-42-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,2,0 and 8 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 352208-42:
(8*3)+(7*5)+(6*2)+(5*2)+(4*0)+(3*8)+(2*4)+(1*2)=115
115 % 10 = 5
So 352208-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO4/c1-18-11-5-3-2-4-9(11)7-14-8-10(13(16)17)6-12(14)15/h2-5,10H,6-8H2,1H3,(H,16,17)
