352530-25-7 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Formyl-4-methylthiophene-2-boronic acid, 97% serves as a key building block in the development of pharmaceuticals. Its unique structure facilitates the formation of essential bonds, contributing to the synthesis of various drug molecules.
Used in Agrochemical Production:
In the agrochemical industry, 5-Formyl-4-methylthiophene-2-boronic acid, 97% is utilized for the synthesis of compounds with pesticidal or herbicidal properties, leveraging its reactivity to form complex molecular structures.
Used in Electronic Materials:
5-Formyl-4-methylthiophene-2-boronic acid, 97% is also employed in the creation of materials for electronic applications, such as organic semiconductors and sensors, where its ability to form stable bonds is crucial for device performance and stability.
Check Digit Verification of cas no
The CAS Registry Mumber 352530-25-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 0 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 352530-25:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*0)+(2*2)+(1*5)=117
117 % 10 = 7
So 352530-25-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BO3S/c1-4-2-6(7(9)10)11-5(4)3-8/h2-3,9-10H,1H3
