352530-42-8 Usage
Uses
Used in Organic Synthesis:
2,4-Dichlorophenylzinc iodide is used as a reagent for cross-coupling reactions to form carbon-carbon and carbon-heteroatom bonds. It plays a crucial role in the synthesis of various organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4-Dichlorophenylzinc iodide is used as a catalyst in various chemical transformations. It is also employed in the production of fine chemicals and pharmaceutical intermediates, contributing to the development of new drugs and therapeutic agents.
Used in Catalyst Development:
2,4-Dichlorophenylzinc iodide is utilized in the development of new catalysts for chemical reactions. Its unique properties make it a valuable component in the design and synthesis of catalysts that can improve the efficiency and selectivity of various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 352530-42-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 0 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 352530-42:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*0)+(2*4)+(1*2)=118
118 % 10 = 8
So 352530-42-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2.HI.Zn/c7-5-2-1-3-6(8)4-5;;/h1-2,4H;1H;/q;;+1/p-1/rC6H3Cl2IZn/c7-4-1-2-6(10-9)5(8)3-4/h1-3H
