352534-88-4 Usage
Uses
Used in Pharmaceutical Industry:
2-BUTOXY-5-CHLOROPHENYLBORONIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form stable complexes with other reagents, facilitating the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2-BUTOXY-5-CHLOROPHENYLBORONIC ACID is used as a precursor in the production of agrochemicals, such as pesticides and herbicides, due to its versatile reactivity and potential to enhance the effectiveness of these compounds.
Used in Materials Science:
2-BUTOXY-5-CHLOROPHENYLBORONIC ACID is utilized as a building block in the synthesis of advanced materials, including polymers and composites, for its unique structure and properties that contribute to the development of materials with specific characteristics and applications.
Used in Chemical Research and Development:
As a valuable component in the field of chemical research and development, 2-BUTOXY-5-CHLOROPHENYLBORONIC ACID is employed as a reagent in various chemical reactions and processes, enabling the discovery and synthesis of novel chemical compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 352534-88-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 4 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 352534-88:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*4)+(2*8)+(1*8)=144
144 % 10 = 4
So 352534-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BClO3/c1-6(2)14-9-4-3-7(11)5-8(9)10(12)13/h3-6,12-13H,1-2H3
