355815-78-0 Usage
Uses
Used in Pharmaceutical Research and Drug Discovery:
3-CHLORO-6-METHYL-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE is used as a research compound for its potential antimicrobial, antiviral, and anticancer properties. Its diverse biological activities make it a promising candidate for the development of new drugs targeting various diseases and conditions.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 3-CHLORO-6-METHYL-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE is utilized as an antimicrobial agent to combat various types of bacteria and fungi. Its ability to inhibit microbial growth and reduce the spread of infections makes it a valuable component in the development of new antimicrobial drugs.
Used in Antiviral Applications:
3-CHLORO-6-METHYL-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE is also used as an antiviral agent, showing potential in inhibiting the replication and spread of viruses. Its antiviral properties make it a candidate for the development of new antiviral medications to treat viral infections and diseases.
Used in Anticancer Applications:
In cancer research, 3-CHLORO-6-METHYL-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE is employed as an anticancer agent. Its potential to target and inhibit the growth of cancer cells, as well as its ability to induce apoptosis, positions it as a promising compound in the development of novel anticancer therapies.
Used as an Intermediate in Organic Synthesis:
3-CHLORO-6-METHYL-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE is also used as an intermediate in the synthesis of various organic compounds. Its unique structure and functional groups make it a versatile building block for the creation of new chemical entities with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 355815-78-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,5,8,1 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 355815-78:
(8*3)+(7*5)+(6*5)+(5*8)+(4*1)+(3*5)+(2*7)+(1*8)=170
170 % 10 = 0
So 355815-78-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2OS/c1-5-2-3-6-7(4-5)15-9(8(6)11)10(14)13-12/h2-4H,12H2,1H3,(H,13,14)
