36563-47-0 Usage
Uses
1. Used in Environmental Analysis:
1-bromo-2-phenoxy-benzene is used as a quantification agent for the detection and measurement of trace polybrominated diphenyl ethers (PBDEs) in biota samples. These samples are typically sourced from areas surrounding electronic waste recycling facilities, where the presence of toxic PBDEs is a concern due to their environmental persistence and potential health risks.
2. Used in Electronic Waste Recycling Industry:
In the context of the electronic waste recycling industry, 1-bromo-2-phenoxy-benzene serves as a valuable tool for monitoring and controlling the release of harmful brominated flame retardants, such as PBDEs, into the environment. By accurately quantifying these contaminants, recycling facilities can implement more effective waste management strategies and reduce the environmental impact of their operations.
3. Used in Research and Development:
1-bromo-2-phenoxy-benzene may also be utilized in research and development settings, where it can contribute to the advancement of analytical chemistry techniques and the understanding of the behavior of brominated compounds in various environmental matrices. This knowledge can lead to the development of new methods for the detection, quantification, and remediation of these pollutants, ultimately benefiting both human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 36563-47-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,6 and 3 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36563-47:
(7*3)+(6*6)+(5*5)+(4*6)+(3*3)+(2*4)+(1*7)=130
130 % 10 = 0
So 36563-47-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H9BrO/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9H
