370107-81-6 Usage
Uses
Used in Pharmaceutical Industry:
2-((1,2,4-oxadiazol-3-yl)methyl)isoindoline-1,3-dione is used as a potential active pharmaceutical ingredient for the development of new drugs, leveraging its oxadiazole and isoindoline-1,3-dione components for their antimicrobial, antifungal, and anticancer properties.
Used in Medicinal Chemistry Research:
2-((1,2,4-oxadiazol-3-yl)methyl)isoindoline-1,3-dione serves as a subject of study in medicinal chemistry, where its structure and properties are investigated to understand its potential applications in the treatment of various diseases and conditions, given the known pharmacological activities of similar compounds.
Further research is essential to explore and confirm the specific uses and properties of 2-((1,2,4-oxadiazol-3-yl)methyl)isoindoline-1,3-dione, as its full potential in the pharmaceutical and medical fields is yet to be determined.
Check Digit Verification of cas no
The CAS Registry Mumber 370107-81-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,0,1,0 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 370107-81:
(8*3)+(7*7)+(6*0)+(5*1)+(4*0)+(3*7)+(2*8)+(1*1)=116
116 % 10 = 6
So 370107-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H7N3O3/c15-10-7-3-1-2-4-8(7)11(16)14(10)5-9-12-6-17-13-9/h1-4,6H,5H2
370107-81-6Relevant articles and documents
Estra-1,3,5 (10)-triene derivatives
-
, (2008/06/13)
Provided is steroid sulfatase inhibitors comprising, as the active ingredient, an estra-1,3,5(10)-triene derivative which is represented by formula (I): {wherein R1 and R2 are the same or different and represent a hydrogen atom, a lower alkyl group or, etc.; R3 represents a hydrogen atom etc.; R4 represents a hydrogen atom etc.; R5 represents a hydrogen atom etc.; R6 represents a cyano group, an amino group, COR53 (wherein R53 represents a substituted lower alkyl group etc.), a substituted or unsubstituted aryl group, a substituted or unsubstituted heterocyclic group, etc}, or pharmaceutically acceptable salts thereof.
