380430-52-4 Usage
Uses
Used in Organic Synthesis:
3-Benzyloxycarbonylphenylboronic acid is used as a building block for constructing complex organic molecules, leveraging its boronic acid functional group to form crucial carbon-carbon and carbon-heteroatom bonds.
Used in the Suzuki-Miyaura Coupling Reaction:
In the field of cross-coupling reactions, 3-Benzyloxycarbonylphenylboronic acid is utilized as a source of the aryl (phenyl) group. Its participation in the Suzuki-Miyaura coupling reaction is pivotal for the formation of carbon-carbon bonds, which are fundamental in creating biaryl compounds.
Used in Selective Functional Group Manipulation:
The benzyloxycarbonyl protective group in 3-Benzyloxycarbonylphenylboronic acid allows chemists to selectively modify other functional groups within a molecule during synthesis. This selective manipulation is crucial for the synthesis of complex organic compounds where the protection and deprotection of functional groups are necessary steps.
Used in Pharmaceutical and Agrochemical Industries:
3-Benzyloxycarbonylphenylboronic acid is employed in the synthesis of pharmaceuticals and agrochemicals, where its ability to form specific bonds and protect functional groups is essential for creating effective and targeted molecules.
Used in Material Science:
In material science, 3-Benzyloxycarbonylphenylboronic acid contributes to the development of new materials with unique properties, such as organic semiconductors and polymers, by enabling the formation of specific molecular structures through its boronic acid functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 380430-52-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,0,4,3 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 380430-52:
(8*3)+(7*8)+(6*0)+(5*4)+(4*3)+(3*0)+(2*5)+(1*2)=124
124 % 10 = 4
So 380430-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BO4/c16-14(19-10-11-5-2-1-3-6-11)12-7-4-8-13(9-12)15(17)18/h1-9,17-18H,10H2
