392714-61-3 Usage
Uses
Used in Pharmaceutical Development:
4-(cyclooctylamino)-4-oxobutanoic acid serves as a building block in the design of novel pharmaceutical compounds, leveraging its distinctive cyclic structure and functional groups to create molecules with specific therapeutic properties.
Used in Medicinal Chemistry Research:
As a synthetic compound, 4-(cyclooctylamino)-4-oxobutanoic acid is utilized in medicinal chemistry for studying its interactions with biological targets, potentially leading to the development of new drugs with improved efficacy and selectivity.
Used in Drug Synthesis:
In the chemical industry, 4-(cyclooctylamino)-4-oxobutanoic acid is employed as an intermediate in the synthesis of complex organic molecules, including those with potential pharmaceutical applications.
Used in Biochemical Studies:
4-(cyclooctylamino)-4-oxobutanoic acid may be used in biochemical research to investigate its effects on enzymatic reactions or to understand its metabolic pathways, providing insights into its biological activity and potential uses in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 392714-61-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,2,7,1 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 392714-61:
(8*3)+(7*9)+(6*2)+(5*7)+(4*1)+(3*4)+(2*6)+(1*1)=163
163 % 10 = 3
So 392714-61-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H21NO3/c14-11(8-9-12(15)16)13-10-6-4-2-1-3-5-7-10/h10H,1-9H2,(H,13,14)(H,15,16)
