400877-10-3 Usage
Uses
Used in Pharmaceutical Research and Development:
P4APA is utilized as a key intermediate in the synthesis of bioactive molecules, contributing to the development of new drugs with potential therapeutic applications. Its versatility in chemical reactions allows for the creation of diverse pharmaceutical compounds.
Used in Antitumor Research:
P4APA is employed as a potential antitumor agent, being studied for its capacity to combat cancer cells. Its specific interactions with biological targets are of interest to researchers seeking novel treatments for various types of cancer.
Used in Antimicrobial Applications:
P4APA has also been investigated for its antimicrobial properties, making it a candidate for use in the development of new antibiotics or antifungal agents to address the growing concern of drug-resistant infections.
Used in Scientific Research:
As a valuable tool in scientific research, P4APA aids in understanding the structure-activity relationships of various biologically active compounds, thereby facilitating the advancement of medicinal chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 400877-10-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,0,8,7 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 400877-10:
(8*4)+(7*0)+(6*0)+(5*8)+(4*7)+(3*7)+(2*1)+(1*0)=123
123 % 10 = 3
So 400877-10-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3/c11-6-9-7-12-13(8-9)10-4-2-1-3-5-10/h1-5,7-8H,6,11H2