40119-17-3 Usage
Uses
Used in Pharmaceutical Industry:
3,4-Dimethoxyphenylhydrazine hydrochloride is used as a reagent for the synthesis of various organic compounds, playing a crucial role in the development of pharmaceutical products. Its ability to participate in chemical reactions makes it a valuable component in creating a range of medications and other health-related compounds.
Used in Chemical Research:
In the field of chemical research, 3,4-Dimethoxyphenylhydrazine hydrochloride serves as a key substance for conducting experiments and exploring new chemical reactions. Its unique properties allow researchers to investigate its behavior under different conditions, potentially leading to the discovery of new applications and uses.
Used in Organic Synthesis:
3,4-Dimethoxyphenylhydrazine hydrochloride is utilized as an intermediate in organic synthesis, contributing to the creation of complex organic molecules. Its presence in the synthesis process can influence the final product's properties, making it an important factor in the development of new organic materials.
Check Digit Verification of cas no
The CAS Registry Mumber 40119-17-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,1 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 40119-17:
(7*4)+(6*0)+(5*1)+(4*1)+(3*9)+(2*1)+(1*7)=73
73 % 10 = 3
So 40119-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O2.ClH/c1-11-7-4-3-6(10-9)5-8(7)12-2;/h3-5,10H,9H2,1-2H3;1H
40119-17-3Relevant articles and documents
The synthesis of phenylhydrazines from bis(2,2,2-trichloroethyl) azodicarboxylates and electron-rich arenes
Dufresne, Claude,Leblanc, Yves,Berthelette, Carl,McCooeye, Chris
, p. 3613 - 3624 (1997)
Phenylhydrazines are readily prepared in a two step sequences using electron rich arenes molecules and bis(2,2,2 trichloroethyl) azodicarboxylate (BTCEAD).
