401646-91-1 Usage
Uses
Used in Organic Synthesis:
(3-AMINOPHENYL)(1-AZEPANYL)METHANONE is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure, which includes a phenyl group and an azepane ring, allows for the formation of diverse chemical entities with potential applications in different industries.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (3-AMINOPHENYL)(1-AZEPANYL)METHANONE is used as a precursor for the development of new pharmaceuticals. Its structural features make it a promising candidate for the synthesis of biologically active molecules that can be further optimized for therapeutic applications.
Used in Pharmaceutical Research:
(3-AMINOPHENYL)(1-AZEPANYL)METHANONE is employed in pharmaceutical research to explore its potential as a starting material for the synthesis of novel drug candidates. Researchers can manipulate its structure to create new compounds with specific biological activities, which can then be tested for their efficacy and safety in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 401646-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,1,6,4 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 401646-91:
(8*4)+(7*0)+(6*1)+(5*6)+(4*4)+(3*6)+(2*9)+(1*1)=121
121 % 10 = 1
So 401646-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N2O/c14-12-7-5-6-11(10-12)13(16)15-8-3-1-2-4-9-15/h5-7,10H,1-4,8-9,14H2
